Difference between revisions of "CPD-19487"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-490 == * common-name: ** α-d-xylose 1-phosphate * smiles: ** c1(c(c(c(co1)o)o)o)op([o-])([o-])=o * inchi-key: ** ilxhfxfppzgenn...") |
(Created page with "Category:metabolite == Metabolite RNASE-III-MRNA-PROCESSING-SUBSTRATE == * common-name: ** rnase iii mrna processing substrate == Reaction(s) known to consume the compound...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite RNASE-III-MRNA-PROCESSING-SUBSTRATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** rnase iii mrna processing substrate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[3.1.26.3-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=rnase iii mrna processing substrate}} |
| − | |||
| − | |||
Revision as of 08:25, 15 March 2021
Contents
Metabolite RNASE-III-MRNA-PROCESSING-SUBSTRATE
- common-name:
- rnase iii mrna processing substrate
