Difference between revisions of "CPD-19488"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ02144 == * transcription-direction: ** negative * right-end-position: ** 82479 * left-end-position: ** 74261 * centisome-position: ** 52.671112...")
(Created page with "Category:metabolite == Metabolite CPD-19488 == * common-name: ** 3-isopropyl-9-(methylthio)-2-oxononanoate * smiles: ** csccccccc(c(=o)c(=o)[o-])c(=o)[o-] * inchi-key: **...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ02144 ==
+
== Metabolite CPD-19488 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** 3-isopropyl-9-(methylthio)-2-oxononanoate
−
* right-end-position:
+
* smiles:
−
** 82479
+
** csccccccc(c(=o)c(=o)[o-])c(=o)[o-]
−
* left-end-position:
+
* inchi-key:
−
** 74261
+
** pbyokogrhhzthq-uhfffaoysa-l
−
* centisome-position:
+
* molecular-weight:
−
** 52.671112   
+
** 260.304
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-18202]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[2.4.1.82-RXN]]
+
* [[RXN-18202]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=3-isopropyl-9-(methylthio)-2-oxononanoate}}
−
* [[ALPHAGALACTOSID-RXN]]
+
{{#set: inchi-key=inchikey=pbyokogrhhzthq-uhfffaoysa-l}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=260.304}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-11501]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-11502]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12088]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17830]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-5337]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-6524]]
 
−
** '''2''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-6525]]
 
−
** '''2''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY0-1301]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
* [[PWY-6527]]
 
−
** '''7''' reactions found over '''7''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=82479}}
 
−
{{#set: left-end-position=74261}}
 
−
{{#set: centisome-position=52.671112    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=6}}
 
−
{{#set: nb pathway associated=5}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-19488

  • common-name:
    • 3-isopropyl-9-(methylthio)-2-oxononanoate
  • smiles:
    • csccccccc(c(=o)c(=o)[o-])c(=o)[o-]
  • inchi-key:
    • pbyokogrhhzthq-uhfffaoysa-l
  • molecular-weight:
    • 260.304

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-19488&oldid=138194"