Difference between revisions of "CPD-19488"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-24183 == == Reaction(s) known to consume the compound == * RXN-22205 == Reaction(s) known to produce the compound == * RXN-222...")
(Created page with "Category:metabolite == Metabolite CPD-19488 == * common-name: ** 3-isopropyl-9-(methylthio)-2-oxononanoate * smiles: ** csccccccc(c(=o)c(=o)[o-])c(=o)[o-] * inchi-key: **...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-24183 ==
+
== Metabolite CPD-19488 ==
 +
* common-name:
 +
** 3-isopropyl-9-(methylthio)-2-oxononanoate
 +
* smiles:
 +
** csccccccc(c(=o)c(=o)[o-])c(=o)[o-]
 +
* inchi-key:
 +
** pbyokogrhhzthq-uhfffaoysa-l
 +
* molecular-weight:
 +
** 260.304
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-22205 ]]
+
* [[RXN-18202]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-22204]]
+
* [[RXN-18202]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=3-isopropyl-9-(methylthio)-2-oxononanoate}}
 +
{{#set: inchi-key=inchikey=pbyokogrhhzthq-uhfffaoysa-l}}
 +
{{#set: molecular-weight=260.304}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-19488

  • common-name:
    • 3-isopropyl-9-(methylthio)-2-oxononanoate
  • smiles:
    • csccccccc(c(=o)c(=o)[o-])c(=o)[o-]
  • inchi-key:
    • pbyokogrhhzthq-uhfffaoysa-l
  • molecular-weight:
    • 260.304

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality