Difference between revisions of "CPD-19488"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-DELTA1-PYRROLINE_5-CARBOXYLATE == * common-name: ** (s)-1-pyrroline-5-carboxylate * smiles: ** c1(=nc(cc1)c(=o)[o-]) * inchi-key: ** dw...") |
(Created page with "Category:metabolite == Metabolite CPD-19488 == * common-name: ** 3-isopropyl-9-(methylthio)-2-oxononanoate * smiles: ** csccccccc(c(=o)c(=o)[o-])c(=o)[o-] * inchi-key: **...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-19488 == |
* common-name: | * common-name: | ||
| − | ** ( | + | ** 3-isopropyl-9-(methylthio)-2-oxononanoate |
* smiles: | * smiles: | ||
| − | ** | + | ** csccccccc(c(=o)c(=o)[o-])c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pbyokogrhhzthq-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 260.304 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-18202]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-18202]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=( | + | {{#set: common-name=3-isopropyl-9-(methylthio)-2-oxononanoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pbyokogrhhzthq-uhfffaoysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=260.304}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-19488
- common-name:
- 3-isopropyl-9-(methylthio)-2-oxononanoate
- smiles:
- csccccccc(c(=o)c(=o)[o-])c(=o)[o-]
- inchi-key:
- pbyokogrhhzthq-uhfffaoysa-l
- molecular-weight:
- 260.304
