Difference between revisions of "CPD-19488"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19395 == * common-name: ** γ-l-glutamyl-glycylglycine * smiles: ** c(nc(ccc(c(=o)[o-])[n+])=o)c(ncc(=o)[o-])=o * inchi-key: **...")
(Created page with "Category:metabolite == Metabolite CPD-293 == * common-name: ** 5-α-pregnane-3,20-dione * smiles: ** cc(=o)[ch]3(cc[ch]4([ch]2(cc[ch]1(cc(=o)ccc(c)1[ch]2ccc(c)34))))...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19395 ==
+
== Metabolite CPD-293 ==
 
* common-name:
 
* common-name:
** γ-l-glutamyl-glycylglycine
+
** 5-α-pregnane-3,20-dione
 
* smiles:
 
* smiles:
** c(nc(ccc(c(=o)[o-])[n+])=o)c(ncc(=o)[o-])=o
+
** cc(=o)[ch]3(cc[ch]4([ch]2(cc[ch]1(cc(=o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** rwazieyjawtklb-yfkpbyrvsa-m
+
** xmrpgkvkisiqbv-bjmcwzgwsa-n
 
* molecular-weight:
 
* molecular-weight:
** 260.226
+
** 316.483
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-18092]]
+
* [[PROGESTERONE-5-ALPHA-REDUCTASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=γ-l-glutamyl-glycylglycine}}
+
{{#set: common-name=5-α-pregnane-3,20-dione}}
{{#set: inchi-key=inchikey=rwazieyjawtklb-yfkpbyrvsa-m}}
+
{{#set: inchi-key=inchikey=xmrpgkvkisiqbv-bjmcwzgwsa-n}}
{{#set: molecular-weight=260.226}}
+
{{#set: molecular-weight=316.483}}

Revision as of 14:57, 5 January 2021

Metabolite CPD-293

  • common-name:
    • 5-α-pregnane-3,20-dione
  • smiles:
    • cc(=o)[ch]3(cc[ch]4([ch]2(cc[ch]1(cc(=o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • xmrpgkvkisiqbv-bjmcwzgwsa-n
  • molecular-weight:
    • 316.483

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality