|
|
| (7 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14903 RXN-14903] == | + | == Metabolite CPD-19490 == |
| − | * direction: | + | * common-name: |
| − | ** left-to-right | + | ** 3-isopropyl-7-(methylthio)-2-oxoheptanoate |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/1.5.5.2 ec-1.5.5.2] | + | ** csccccc(c(=o)c(=o)[o-])c(=o)[o-] |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[ETR-Quinones]][c] '''+''' 1 [[PRO]][c] '''=>''' 1 [[ETR-Quinols]][c] '''+''' 1 [[L-DELTA1-PYRROLINE_5-CARBOXYLATE]][c] '''+''' 1 [[PROTON]][c]
| + | ** xxjzwlkrfpcklb-uhfffaoysa-l |
| − | == Gene(s) associated with this reaction ==
| + | * molecular-weight: |
| − | * Gene: [[SJ09783]] | + | ** 232.251 |
| − | ** Category: [[orthology]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | + | * [[RXN-18206]] |
| − | == Pathway(s) == | + | == Reaction(s) known to produce the compound == |
| − | * [[PWY-6922]], L-Nδ-acetylornithine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6922 PWY-6922] | + | * [[RXN-18206]] |
| − | ** '''5''' reactions found over '''7''' reactions in the full pathway
| + | == Reaction(s) of unknown directionality == |
| − | * [[PROUT-PWY]], L-proline degradation: [http://metacyc.org/META/NEW-IMAGE?object=PROUT-PWY PROUT-PWY]
| + | {{#set: common-name=3-isopropyl-7-(methylthio)-2-oxoheptanoate}} |
| − | ** '''2''' reactions found over '''3''' reactions in the full pathway
| + | {{#set: inchi-key=inchikey=xxjzwlkrfpcklb-uhfffaoysa-l}} |
| − | * [[PWY-5737]], (5R)-carbapenem carboxylate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5737 PWY-5737]
| + | {{#set: molecular-weight=232.251}} |
| − | ** '''1''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[CITRULBIO-PWY]], L-citrulline biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=CITRULBIO-PWY CITRULBIO-PWY]
| |
| − | ** '''7''' reactions found over '''8''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23785 23785]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P95629 P95629]
| |
| − | ** [http://www.uniprot.org/uniprot/Q59206 Q59206]
| |
| − | ** [http://www.uniprot.org/uniprot/P74275 P74275]
| |
| − | ** [http://www.uniprot.org/uniprot/P10503 P10503]
| |
| − | ** [http://www.uniprot.org/uniprot/Q51873 Q51873]
| |
| − | ** [http://www.uniprot.org/uniprot/Q59426 Q59426]
| |
| − | ** [http://www.uniprot.org/uniprot/O24897 O24897]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9K0Z9 Q9K0Z9]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9JSY1 Q9JSY1]
| |
| − | ** [http://www.uniprot.org/uniprot/P09546 P09546]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PMG0 Q9PMG0]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9ZN12 Q9ZN12]
| |
| − | ** [http://www.uniprot.org/uniprot/Q04499 Q04499]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R01253 R01253]
| |
| − | {{#set: direction=left-to-right}} | |
| − | {{#set: ec-number=ec-1.5.5.2}}
| |
| − | {{#set: nb gene associated=1}} | |
| − | {{#set: nb pathway associated=4}}
| |
| − | {{#set: reconstruction category=orthology}} | |
| − | {{#set: reconstruction tool=pantograph}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
| |
