Difference between revisions of "CPD-19491"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ19644 == * transcription-direction: ** positive * right-end-position: ** 35294 * left-end-position: ** 3382 * centisome-position: ** 1.5125833...")
 
(Created page with "Category:metabolite == Metabolite CPD-19491 == * common-name: ** 3-isopropyl-6-(methylthio)-2-oxohexanoate * smiles: ** c(c(cccsc)c(=o)c(=o)[o-])(=o)[o-] * inchi-key: ** w...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ19644 ==
+
== Metabolite CPD-19491 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 3-isopropyl-6-(methylthio)-2-oxohexanoate
−
* right-end-position:
+
* smiles:
−
** 35294
+
** c(c(cccsc)c(=o)c(=o)[o-])(=o)[o-]
−
* left-end-position:
+
* inchi-key:
−
** 3382
+
** wrgktdwhjsbcjr-uhfffaoysa-l
−
* centisome-position:
+
* molecular-weight:
−
** 1.5125833   
+
** 218.224
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-18208]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[RXN-13675]]
+
* [[RXN-18208]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=3-isopropyl-6-(methylthio)-2-oxohexanoate}}
−
* [[RXN-3741]]
+
{{#set: inchi-key=inchikey=wrgktdwhjsbcjr-uhfffaoysa-l}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=218.224}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-6641]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7112]]
 
−
** '''3''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-2161B]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
* [[PWY-6842]]
 
−
** '''5''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-4061]]
 
−
** '''4''' reactions found over '''8''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=35294}}
 
−
{{#set: left-end-position=3382}}
 
−
{{#set: centisome-position=1.5125833    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=3}}
 
−
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-19491

  • common-name:
    • 3-isopropyl-6-(methylthio)-2-oxohexanoate
  • smiles:
    • c(c(cccsc)c(=o)c(=o)[o-])(=o)[o-]
  • inchi-key:
    • wrgktdwhjsbcjr-uhfffaoysa-l
  • molecular-weight:
    • 218.224

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-19491&oldid=137067"