Difference between revisions of "CPD-19492"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-85 == * common-name: ** 1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one * smiles: ** csccc(c([o-])=co)=o * inchi-key: ** cilxjjlqptuu...") |
(Created page with "Category:metabolite == Metabolite CPD-19492 == * common-name: ** 3-ethyl-2-oxosuccinate * smiles: ** ccc(c([o-])=o)c(c(=o)[o-])=o * inchi-key: ** ouglpihdpbrsid-uhfffaoysa...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-19492 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-ethyl-2-oxosuccinate |
* smiles: | * smiles: | ||
| − | ** | + | ** ccc(c([o-])=o)c(c(=o)[o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ouglpihdpbrsid-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 158.11 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-18210]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-18210]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-ethyl-2-oxosuccinate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ouglpihdpbrsid-uhfffaoysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=158.11}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-19492
- common-name:
- 3-ethyl-2-oxosuccinate
- smiles:
- ccc(c([o-])=o)c(c(=o)[o-])=o
- inchi-key:
- ouglpihdpbrsid-uhfffaoysa-l
- molecular-weight:
- 158.11
