Difference between revisions of "CPD-195"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ALLANTOATE == * common-name: ** allantoate * smiles: ** c(c(=o)[o-])(nc(=o)n)nc(=o)n * inchi-key: ** nucljnswzchrkl-uhfffaoysa-m * molecu...") |
(Created page with "Category:metabolite == Metabolite CPD-195 == * common-name: ** octanoate * smiles: ** cccccccc(=o)[o-] * inchi-key: ** wwzkqhockizlma-uhfffaoysa-m * molecular-weight: ** 1...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-195 == |
* common-name: | * common-name: | ||
| − | ** | + | ** octanoate |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccccc(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wwzkqhockizlma-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 143.205 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[R223-RXN]] |
| + | * [[RXN0-5098]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[3.1.2.19-RXN-CPD-196/WATER//CPD-195/CO-A/PROTON.35.]] | ||
| + | * [[ACECOATRANS-RXN-CPD-196/ACET//CPD-195/ACETYL-COA.33.]] | ||
| + | * [[R222-RXN]] | ||
| + | * [[THIOESTER-RXN[CCO-CYTOSOL]-CPD-196/WATER//CPD-195/CO-A/PROTON.48.]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=octanoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wwzkqhockizlma-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=143.205}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-195
- common-name:
- octanoate
- smiles:
- cccccccc(=o)[o-]
- inchi-key:
- wwzkqhockizlma-uhfffaoysa-m
- molecular-weight:
- 143.205
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
- 3.1.2.19-RXN-CPD-196/WATER//CPD-195/CO-A/PROTON.35.
- ACECOATRANS-RXN-CPD-196/ACET//CPD-195/ACETYL-COA.33.
- R222-RXN
- [[THIOESTER-RXN[CCO-CYTOSOL]-CPD-196/WATER//CPD-195/CO-A/PROTON.48.]]
