Difference between revisions of "CPD-196"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13171 == * common-name: ** 15,9'-di-cis-phytofluene * smiles: ** cc(=cccc(=cccc(=cc=cc(=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c)c)c)c *...")
(Created page with "Category:metabolite == Metabolite CPD-8166 == * common-name: ** 1-18:2-2-18:3-monogalactosyldiacylglycerol * smiles: ** cccccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13171 ==
+
== Metabolite CPD-8166 ==
 
* common-name:
 
* common-name:
** 15,9'-di-cis-phytofluene
+
** 1-18:2-2-18:3-monogalactosyldiacylglycerol
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(=cc=cc(=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c)c)c)c)c
+
** cccccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))oc(=o)cccccccc=ccc=ccc=ccc)=o
 
* inchi-key:
 
* inchi-key:
** ovsvtcfnlsgamm-iqemyqfosa-n
+
** drlqfbrxasrgdp-bubqrnscsa-n
 
* molecular-weight:
 
* molecular-weight:
** 542.93
+
** 777.089
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12244]]
+
* [[RXN-8368]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12243]]
+
* [[RXN-8367]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=15,9'-di-cis-phytofluene}}
+
{{#set: common-name=1-18:2-2-18:3-monogalactosyldiacylglycerol}}
{{#set: inchi-key=inchikey=ovsvtcfnlsgamm-iqemyqfosa-n}}
+
{{#set: inchi-key=inchikey=drlqfbrxasrgdp-bubqrnscsa-n}}
{{#set: molecular-weight=542.93}}
+
{{#set: molecular-weight=777.089}}

Revision as of 18:58, 14 January 2021

Metabolite CPD-8166

  • common-name:
    • 1-18:2-2-18:3-monogalactosyldiacylglycerol
  • smiles:
    • cccccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))oc(=o)cccccccc=ccc=ccc=ccc)=o
  • inchi-key:
    • drlqfbrxasrgdp-bubqrnscsa-n
  • molecular-weight:
    • 777.089

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality