Difference between revisions of "CPD-196"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-HYDROXYADIPYL-COA == * common-name: ** (3s)-hydroxyadipyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc(=o)[o-])o)=o)cop(=o)(op(...") |
(Created page with "Category:metabolite == Metabolite CPD-196 == * common-name: ** octanoyl-coa * smiles: ** cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o...") |
||
(4 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-196 == |
* common-name: | * common-name: | ||
− | ** | + | ** octanoyl-coa |
* smiles: | * smiles: | ||
− | ** | + | ** cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** kqmzyoxobsxmii-cecatxlmsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 889.7 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[3.1.2.19-RXN-CPD-196/WATER//CPD-195/CO-A/PROTON.35.]] |
− | * [[ | + | * [[ACACT4]] |
+ | * [[ACACT4h]] | ||
+ | * [[ACECOATRANS-RXN-CPD-196/ACET//CPD-195/ACETYL-COA.33.]] | ||
+ | * [[ACOA80OR]] | ||
+ | * [[RXN-12669]] | ||
+ | * [[RXN-14229]] | ||
+ | * [[THIOESTER-RXN[CCO-CYTOSOL]-CPD-196/WATER//CPD-195/CO-A/PROTON.48.]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[ACACT4]] |
− | * [[ | + | * [[R223-RXN]] |
+ | * [[RXN-13617]] | ||
+ | * [[RXN-14229]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=octanoyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kqmzyoxobsxmii-cecatxlmsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=889.7}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-196
- common-name:
- octanoyl-coa
- smiles:
- cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- kqmzyoxobsxmii-cecatxlmsa-j
- molecular-weight:
- 889.7
Reaction(s) known to consume the compound
- 3.1.2.19-RXN-CPD-196/WATER//CPD-195/CO-A/PROTON.35.
- ACACT4
- ACACT4h
- ACECOATRANS-RXN-CPD-196/ACET//CPD-195/ACETYL-COA.33.
- ACOA80OR
- RXN-12669
- RXN-14229
- [[THIOESTER-RXN[CCO-CYTOSOL]-CPD-196/WATER//CPD-195/CO-A/PROTON.48.]]