Difference between revisions of "CPD-196"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1A0-6303 RXN1A0-6303] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org...")
 
(Created page with "Category:metabolite == Metabolite CPD-196 == * common-name: ** octanoyl-coa * smiles: ** cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1A0-6303 RXN1A0-6303] ==
+
== Metabolite CPD-196 ==
* direction:
+
* common-name:
** left-to-right
+
** octanoyl-coa
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.3.1 ec-1.3.1]
+
** cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
== Reaction formula ==
+
* inchi-key:
* 1 [[Hepta-oxo-hexadecanoyl-ACPs]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[Actinorhodin-Intermediate-2]][c] '''+''' 1 [[NADP]][c]
+
** kqmzyoxobsxmii-cecatxlmsa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ19012]]
+
** 889.7
** Category: [[orthology]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[3.1.2.19-RXN-CPD-196/WATER//CPD-195/CO-A/PROTON.35.]]
* Gene: [[SJ15799]]
+
* [[ACACT4]]
** Category: [[orthology]]
+
* [[ACACT4h]]
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[ACECOATRANS-RXN-CPD-196/ACET//CPD-195/ACETYL-COA.33.]]
== Pathway(s) ==
+
* [[ACOA80OR]]
* [[PWY1A0-6325]], actinorhodin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY1A0-6325 PWY1A0-6325]
+
* [[RXN-12669]]
** '''1''' reactions found over '''12''' reactions in the full pathway
+
* [[RXN-14229]]
== Reconstruction information  ==
+
* [[THIOESTER-RXN[CCO-CYTOSOL]-CPD-196/WATER//CPD-195/CO-A/PROTON.48.]]
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
== External links  ==
+
* [[ACACT4]]
{{#set: direction=left-to-right}}
+
* [[R223-RXN]]
{{#set: ec-number=ec-1.3.1}}
+
* [[RXN-13617]]
{{#set: nb gene associated=2}}
+
* [[RXN-14229]]
{{#set: nb pathway associated=1}}
+
== Reaction(s) of unknown directionality ==
{{#set: reconstruction category=orthology}}
+
{{#set: common-name=octanoyl-coa}}
{{#set: reconstruction tool=pantograph}}
+
{{#set: inchi-key=inchikey=kqmzyoxobsxmii-cecatxlmsa-j}}
{{#set: reconstruction comment=n.a}}
+
{{#set: molecular-weight=889.7}}
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-196

  • common-name:
    • octanoyl-coa
  • smiles:
    • cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • kqmzyoxobsxmii-cecatxlmsa-j
  • molecular-weight:
    • 889.7

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality