Difference between revisions of "CPD-19726"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GLY == * common-name: ** glycine * smiles: ** c([n+])c([o-])=o * inchi-key: ** dhmqdgoqfoqnfh-uhfffaoysa-n * molecular-weight: ** 75.067...")
(Created page with "Category:metabolite == Metabolite CPD-13533 == * common-name: ** (3r)-3-hydroxypentanoyl-coa * smiles: ** ccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GLY ==
+
== Metabolite CPD-13533 ==
 
* common-name:
 
* common-name:
** glycine
+
** (3r)-3-hydroxypentanoyl-coa
 
* smiles:
 
* smiles:
** c([n+])c([o-])=o
+
** ccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
 
* inchi-key:
 
* inchi-key:
** dhmqdgoqfoqnfh-uhfffaoysa-n
+
** yygypcrwzmlsgk-orumcernsa-j
 
* molecular-weight:
 
* molecular-weight:
** 75.067
+
** 863.619
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.4.3.19-RXN]]
+
* [[RXN-12560]]
* [[ALANINE--GLYOXYLATE-AMINOTRANSFERASE-RXN]]
 
* [[GCVP-RXN]]
 
* [[GLUTATHIONE-SYN-RXN]]
 
* [[GLYCINE--TRNA-LIGASE-RXN]]
 
* [[GLYCINE-AMINOTRANSFERASE-RXN]]
 
* [[GLYCINE-N-METHYLTRANSFERASE-RXN]]
 
* [[GLYOHMETRANS-RXN]]
 
* [[GLYRIBONUCSYN-RXN]]
 
* [[RXN-10821]]
 
* [[RXN-12614]]
 
* [[RXN-13404]]
 
* [[RXN-13406]]
 
* [[biomass_rxn]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
* [[2.3.2.15-RXN]]
 
* [[AKBLIG-RXN]]
 
* [[ALANINE--GLYOXYLATE-AMINOTRANSFERASE-RXN]]
 
* [[GCVP-RXN]]
 
* [[GLYCINE-AMINOTRANSFERASE-RXN]]
 
* [[GLYOHMETRANS-RXN]]
 
* [[LTAA-RXN]]
 
* [[RXN-13677]]
 
* [[RXN-6622]]
 
* [[RXN-6642]]
 
* [[RXN-9896]]
 
* [[RXN0-5234]]
 
* [[RXN0-6974]]
 
* [[RXN0-6977]]
 
* [[RXN0-6982]]
 
* [[RXN0-6983]]
 
* [[RXN0-6984]]
 
* [[RXN0-6987]]
 
* [[RXN0-6988]]
 
* [[THREONINE-ALDOLASE-RXN]]
 
</div>
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=glycine}}
+
{{#set: common-name=(3r)-3-hydroxypentanoyl-coa}}
{{#set: inchi-key=inchikey=dhmqdgoqfoqnfh-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=yygypcrwzmlsgk-orumcernsa-j}}
{{#set: molecular-weight=75.067}}
+
{{#set: molecular-weight=863.619}}

Revision as of 15:28, 5 January 2021

Metabolite CPD-13533

  • common-name:
    • (3r)-3-hydroxypentanoyl-coa
  • smiles:
    • ccc(cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o)o
  • inchi-key:
    • yygypcrwzmlsgk-orumcernsa-j
  • molecular-weight:
    • 863.619

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality