Difference between revisions of "CPD-20012"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-20012 == * common-name: ** naringenin chalcone * smiles: ** c2(c(c=cc(c1(c(=cc(=cc(o)=1)o)o))=o)=cc=c(c=2)o) * inchi-key: ** yqhmwtpy...")
(Created page with "Category:metabolite == Metabolite DIHYDROXYPHENYLGLYCOLALDEHYDE == * common-name: ** 3,4-dihydroxyphenylglycolaldehyde * smiles: ** c(=o)c(o)c1(c=cc(o)=c(o)c=1) * inchi-ke...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-20012 ==
+
== Metabolite DIHYDROXYPHENYLGLYCOLALDEHYDE ==
 
* common-name:
 
* common-name:
** naringenin chalcone
+
** 3,4-dihydroxyphenylglycolaldehyde
 
* smiles:
 
* smiles:
** c2(c(c=cc(c1(c(=cc(=cc(o)=1)o)o))=o)=cc=c(c=2)o)
+
** c(=o)c(o)c1(c=cc(o)=c(o)c=1)
 
* inchi-key:
 
* inchi-key:
** yqhmwtpyorbcmf-zzxkwvifsa-n
+
** yugmcljiwgekck-qmmmgpobsa-n
 
* molecular-weight:
 
* molecular-weight:
** 272.257
+
** 168.149
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[APIGNAR-RXN]]
+
* [[RXN-10911]]
 +
* [[RXN-10912]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
+
* [[RXN-10907]]
 +
* [[RXN-10908]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=naringenin chalcone}}
+
{{#set: common-name=3,4-dihydroxyphenylglycolaldehyde}}
{{#set: inchi-key=inchikey=yqhmwtpyorbcmf-zzxkwvifsa-n}}
+
{{#set: inchi-key=inchikey=yugmcljiwgekck-qmmmgpobsa-n}}
{{#set: molecular-weight=272.257}}
+
{{#set: molecular-weight=168.149}}

Revision as of 08:29, 15 March 2021

Metabolite DIHYDROXYPHENYLGLYCOLALDEHYDE

  • common-name:
    • 3,4-dihydroxyphenylglycolaldehyde
  • smiles:
    • c(=o)c(o)c1(c=cc(o)=c(o)c=1)
  • inchi-key:
    • yugmcljiwgekck-qmmmgpobsa-n
  • molecular-weight:
    • 168.149

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality