Difference between revisions of "CPD-201"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-201 == * common-name: ** 4-hydroxybenzoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(c1(=cc=c(o)c=c1))=o)cop(=o)(op(=o)(occ2(c(op(...")
(Created page with "Category:metabolite == Metabolite CPD66-23 == * common-name: ** 17-α-hydroxypregnenolone * smiles: ** cc(=o)c3(o)(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34)))) *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-201 ==
+
== Metabolite CPD66-23 ==
 
* common-name:
 
* common-name:
** 4-hydroxybenzoyl-coa
+
** 17-α-hydroxypregnenolone
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(c1(=cc=c(o)c=c1))=o)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+
** cc(=o)c3(o)(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** ltvxpvbfjbtnij-tyhxjlicsa-j
+
** jergucijoxjxhf-tvwvxwensa-n
 
* molecular-weight:
 
* molecular-weight:
** 883.61
+
** 332.482
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN66-350]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11246]]
+
* [[RXN66-350]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-hydroxybenzoyl-coa}}
+
{{#set: common-name=17-α-hydroxypregnenolone}}
{{#set: inchi-key=inchikey=ltvxpvbfjbtnij-tyhxjlicsa-j}}
+
{{#set: inchi-key=inchikey=jergucijoxjxhf-tvwvxwensa-n}}
{{#set: molecular-weight=883.61}}
+
{{#set: molecular-weight=332.482}}

Revision as of 08:29, 15 March 2021

Metabolite CPD66-23

  • common-name:
    • 17-α-hydroxypregnenolone
  • smiles:
    • cc(=o)c3(o)(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • jergucijoxjxhf-tvwvxwensa-n
  • molecular-weight:
    • 332.482

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality