Difference between revisions of "CPD-201"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-190 == * common-name: ** n-acetyl-α-d-glucosaminyl-diphosphodolichol == Reaction(s) known to consume the compound == * 2.4.1....")
(Created page with "Category:metabolite == Metabolite CPD-201 == * common-name: ** 4-hydroxybenzoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(c1(=cc=c(o)c=c1))=o)cop(=o)(op(=o)(occ2(c(op(...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-190 ==
+
== Metabolite CPD-201 ==
 
* common-name:
 
* common-name:
** n-acetyl-α-d-glucosaminyl-diphosphodolichol
+
** 4-hydroxybenzoyl-coa
 +
* smiles:
 +
** cc(c)(c(o)c(=o)nccc(=o)nccsc(c1(=cc=c(o)c=c1))=o)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 +
* inchi-key:
 +
** ltvxpvbfjbtnij-tyhxjlicsa-j
 +
* molecular-weight:
 +
** 883.61
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.4.1.141-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.8.15-RXN]]
+
* [[RXN-11246]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetyl-α-d-glucosaminyl-diphosphodolichol}}
+
{{#set: common-name=4-hydroxybenzoyl-coa}}
 +
{{#set: inchi-key=inchikey=ltvxpvbfjbtnij-tyhxjlicsa-j}}
 +
{{#set: molecular-weight=883.61}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-201

  • common-name:
    • 4-hydroxybenzoyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(c1(=cc=c(o)c=c1))=o)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • ltvxpvbfjbtnij-tyhxjlicsa-j
  • molecular-weight:
    • 883.61

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality