Difference between revisions of "CPD-202"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite P3I == * common-name: ** pppi * smiles: ** [o-]p(op(=o)(op([o-])(=o)[o-])[o-])([o-])=o * inchi-key: ** unxrwkveancorm-uhfffaoysa-i * mole...")
(Created page with "Category:metabolite == Metabolite CPD-202 == * common-name: ** choloyl-coa * smiles: ** cc(ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite P3I ==
+
== Metabolite CPD-202 ==
 
* common-name:
 
* common-name:
** pppi
+
** choloyl-coa
 
* smiles:
 
* smiles:
** [o-]p(op(=o)(op([o-])(=o)[o-])[o-])([o-])=o
+
** cc(ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])[ch]5(cc[ch]6([ch]7(c(o)c[ch]4(cc(o)ccc(c)4[ch](cc(o)c(c)56)7))))
 
* inchi-key:
 
* inchi-key:
** unxrwkveancorm-uhfffaoysa-i
+
** zkwnotqhfkyunu-jgciywtlsa-j
 
* molecular-weight:
 
* molecular-weight:
** 252.915
+
** 1154.064
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[TRIPHOSPHATASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[4.2.3.12-RXN]]
+
* [[2.3.1.176-RXN]]
* [[BTUR2-RXN]]
 
* [[COBALADENOSYLTRANS-RXN]]
 
* [[DGTPTRIPHYDRO-RXN]]
 
* [[R344-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pppi}}
+
{{#set: common-name=choloyl-coa}}
{{#set: inchi-key=inchikey=unxrwkveancorm-uhfffaoysa-i}}
+
{{#set: inchi-key=inchikey=zkwnotqhfkyunu-jgciywtlsa-j}}
{{#set: molecular-weight=252.915}}
+
{{#set: molecular-weight=1154.064}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-202

  • common-name:
    • choloyl-coa
  • smiles:
    • cc(ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])[ch]5(cc[ch]6([ch]7(c(o)c[ch]4(cc(o)ccc(c)4[ch](cc(o)c(c)56)7))))
  • inchi-key:
    • zkwnotqhfkyunu-jgciywtlsa-j
  • molecular-weight:
    • 1154.064

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality