Difference between revisions of "CPD-206"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-381 == * common-name: ** (s)-2-hydroxyglutarate * smiles: ** c(=o)([o-])c(o)ccc(=o)[o-] * inchi-key: ** hwxbtnavrsuojr-vkhmyheasa-l *...") |
(Created page with "Category:metabolite == Metabolite D-GLUCOSAMINE-6-P == * common-name: ** d-glucosamine 6-phosphate == Reaction(s) known to consume the compound == * L-GLN-FRUCT-6-P-AMIN...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite D-GLUCOSAMINE-6-P == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-glucosamine 6-phosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-glucosamine 6-phosphate}} |
| − | |||
| − | |||
Revision as of 13:09, 14 January 2021
Contents
Metabolite D-GLUCOSAMINE-6-P
- common-name:
- d-glucosamine 6-phosphate
