Difference between revisions of "CPD-206"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ16999 == * transcription-direction: ** positive * right-end-position: ** 261277 * left-end-position: ** 250697 * centisome-position: ** 91.686325...")
(Created page with "Category:metabolite == Metabolite CPD-206 == * common-name: ** phytanoyl-coa * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ16999 ==
+
== Metabolite CPD-206 ==
* transcription-direction:
+
* common-name:
** positive
+
** phytanoyl-coa
* right-end-position:
+
* smiles:
** 261277
+
** cc(c)cccc(c)cccc(c)cccc(c)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
* left-end-position:
+
* inchi-key:
** 250697
+
** nrjqghhzmsouen-hhvnvsiesa-j
* centisome-position:
+
* molecular-weight:
** 91.686325   
+
** 1058.022
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[1.14.11.18-RXN]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[3.4.21.92-RXN]]
+
* [[RXN66-482]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=phytanoyl-coa}}
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=nrjqghhzmsouen-hhvnvsiesa-j}}
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=1058.022}}
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=261277}}
 
{{#set: left-end-position=250697}}
 
{{#set: centisome-position=91.686325    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-206

  • common-name:
    • phytanoyl-coa
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc(c)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • nrjqghhzmsouen-hhvnvsiesa-j
  • molecular-weight:
    • 1058.022

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality