Difference between revisions of "CPD-20680"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ09115 == * transcription-direction: ** positive * right-end-position: ** 302472 * left-end-position: ** 263285 * centisome-position: ** 61.936295...")
(Created page with "Category:metabolite == Metabolite CPD-20680 == * common-name: ** diadinoxanthin * smiles: ** cc(c=cc=c(c#cc1(=c(c)cc(o)cc(c)(c)1))c)=cc=cc=c(c)c=cc=c(c)c=cc23(c(c)(c)cc(o)...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ09115 ==
+
== Metabolite CPD-20680 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** diadinoxanthin
−
* right-end-position:
+
* smiles:
−
** 302472
+
** cc(c=cc=c(c#cc1(=c(c)cc(o)cc(c)(c)1))c)=cc=cc=c(c)c=cc=c(c)c=cc23(c(c)(c)cc(o)cc(c)(o2)3)
−
* left-end-position:
+
* inchi-key:
−
** 263285
+
** oghzcsinimwcsb-ghiqlmqgsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 61.936295   
+
** 582.865
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-19200]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[ATPASE-RXN]]
+
* [[RXN-19202]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=diadinoxanthin}}
−
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
+
{{#set: inchi-key=inchikey=oghzcsinimwcsb-ghiqlmqgsa-n}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=582.865}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12195]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12196]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN0-5462]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7210]]
 
−
** '''8''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-7198]]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-7184]]
 
−
** '''9''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-6545]]
 
−
** '''8''' reactions found over '''9''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=302472}}
 
−
{{#set: left-end-position=263285}}
 
−
{{#set: centisome-position=61.936295    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-20680

  • common-name:
    • diadinoxanthin
  • smiles:
    • cc(c=cc=c(c#cc1(=c(c)cc(o)cc(c)(c)1))c)=cc=cc=c(c)c=cc=c(c)c=cc23(c(c)(c)cc(o)cc(c)(o2)3)
  • inchi-key:
    • oghzcsinimwcsb-ghiqlmqgsa-n
  • molecular-weight:
    • 582.865

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-20680&oldid=137416"