Difference between revisions of "CPD-20680"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-67 == * common-name: ** 2-phosphoglycolate * smiles: ** c(op([o-])(=o)[o-])c([o-])=o * inchi-key: ** ascfnmcahfubco-uhfffaoysa-k * mo...") |
(Created page with "Category:metabolite == Metabolite Adenine57-Adenine58-tRNAs == * common-name: ** an adenine57/adenine58 in trna == Reaction(s) known to consume the compound == * RXN-124...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Adenine57-Adenine58-tRNAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** an adenine57/adenine58 in trna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-12469]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an adenine57/adenine58 in trna}} |
| − | |||
| − | |||
Revision as of 15:26, 5 January 2021
Contents
Metabolite Adenine57-Adenine58-tRNAs
- common-name:
- an adenine57/adenine58 in trna
