Difference between revisions of "CPD-20680"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ06336 == * transcription-direction: ** negative * right-end-position: ** 149521 * left-end-position: ** 141597 * centisome-position: ** 29.563183...") |
(Created page with "Category:metabolite == Metabolite CPD-692 == * common-name: ** (+)-cis-abscisic aldehyde * smiles: ** cc(=cc=o)c=cc1(c(c)(c)cc(=o)c=c(c)1)o * inchi-key: ** rikwdzwvhuiuam-...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-692 == |
| − | * | + | * common-name: |
| − | ** | + | ** (+)-cis-abscisic aldehyde |
| − | * | + | * smiles: |
| − | ** | + | ** cc(=cc=o)c=cc1(c(c)(c)cc(=o)c=c(c)1)o |
| − | * | + | * inchi-key: |
| − | ** | + | ** rikwdzwvhuiuam-kicrzjjpsa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 248.321 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[1.2.3.14-RXN]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[1.1.1.288-RXN]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=(+)-cis-abscisic aldehyde}} | |
| − | + | {{#set: inchi-key=inchikey=rikwdzwvhuiuam-kicrzjjpsa-n}} | |
| − | + | {{#set: molecular-weight=248.321}} | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Revision as of 20:32, 18 December 2020
Contents
Metabolite CPD-692
- common-name:
- (+)-cis-abscisic aldehyde
- smiles:
- cc(=cc=o)c=cc1(c(c)(c)cc(=o)c=c(c)1)o
- inchi-key:
- rikwdzwvhuiuam-kicrzjjpsa-n
- molecular-weight:
- 248.321
