Difference between revisions of "CPD-20693"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16025 RXN-16025] == * direction: ** left-to-right * common-name: ** 1-acylglycerol-3-phosphate...") |
(Created page with "Category:metabolite == Metabolite CPD-20693 == * common-name: ** diatoxanthin * smiles: ** cc(=cc=cc=c(c)c=cc=c(c#cc1(=c(c)cc(o)cc(c)(c)1))c)c=cc=c(c)c=cc2(c(c)(c)cc(o)cc(...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-20693 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** diatoxanthin |
− | * | + | * smiles: |
− | + | ** cc(=cc=cc=c(c)c=cc=c(c#cc1(=c(c)cc(o)cc(c)(c)1))c)c=cc=c(c)c=cc2(c(c)(c)cc(o)cc(c)=2) | |
− | ** | + | * inchi-key: |
− | == | + | ** hnyjhqmusvnwpv-drcjtwaysa-n |
− | + | * molecular-weight: | |
− | == | + | ** 566.865 |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[RXN-19202]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-19200]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=diatoxanthin}} | |
− | + | {{#set: inchi-key=inchikey=hnyjhqmusvnwpv-drcjtwaysa-n}} | |
− | + | {{#set: molecular-weight=566.865}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | * | ||
− | |||
− | == | ||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-20693
- common-name:
- diatoxanthin
- smiles:
- cc(=cc=cc=c(c)c=cc=c(c#cc1(=c(c)cc(o)cc(c)(c)1))c)c=cc=c(c)c=cc2(c(c)(c)cc(o)cc(c)=2)
- inchi-key:
- hnyjhqmusvnwpv-drcjtwaysa-n
- molecular-weight:
- 566.865