Difference between revisions of "CPD-20693"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Hypoxanthine-In-tRNAs-34s == * common-name: ** a hypoxanthine 34 in trnas == Reaction(s) known to consume the compound == * RXN-13997...") |
(Created page with "Category:metabolite == Metabolite CPD-20693 == * common-name: ** diatoxanthin * smiles: ** cc(=cc=cc=c(c)c=cc=c(c#cc1(=c(c)cc(o)cc(c)(c)1))c)c=cc=c(c)c=cc2(c(c)(c)cc(o)cc(...") |
||
| (3 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-20693 == |
* common-name: | * common-name: | ||
| − | ** | + | ** diatoxanthin |
| + | * smiles: | ||
| + | ** cc(=cc=cc=c(c)c=cc=c(c#cc1(=c(c)cc(o)cc(c)(c)1))c)c=cc=c(c)c=cc2(c(c)(c)cc(o)cc(c)=2) | ||
| + | * inchi-key: | ||
| + | ** hnyjhqmusvnwpv-drcjtwaysa-n | ||
| + | * molecular-weight: | ||
| + | ** 566.865 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-19202]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-19200]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=diatoxanthin}} |
| + | {{#set: inchi-key=inchikey=hnyjhqmusvnwpv-drcjtwaysa-n}} | ||
| + | {{#set: molecular-weight=566.865}} | ||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-20693
- common-name:
- diatoxanthin
- smiles:
- cc(=cc=cc=c(c)c=cc=c(c#cc1(=c(c)cc(o)cc(c)(c)1))c)c=cc=c(c)c=cc2(c(c)(c)cc(o)cc(c)=2)
- inchi-key:
- hnyjhqmusvnwpv-drcjtwaysa-n
- molecular-weight:
- 566.865
