Difference between revisions of "CPD-20693"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.3.66-RXN 3.1.3.66-RXN] == * direction: ** left-to-right * common-name: ** phosphatidylinositol-...")
(Created page with "Category:metabolite == Metabolite CPD-20693 == * common-name: ** diatoxanthin * smiles: ** cc(=cc=cc=c(c)c=cc=c(c#cc1(=c(c)cc(o)cc(c)(c)1))c)c=cc=c(c)c=cc2(c(c)(c)cc(o)cc(...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.3.66-RXN 3.1.3.66-RXN] ==
+
== Metabolite CPD-20693 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** phosphatidylinositol-3,4-bisphosphate 4-phosphatase
+
** diatoxanthin
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/3.1.3.66 ec-3.1.3.66]
+
** cc(=cc=cc=c(c)c=cc=c(c#cc1(=c(c)cc(o)cc(c)(c)1))c)c=cc=c(c)c=cc2(c(c)(c)cc(o)cc(c)=2)
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[1-PHOSPHATIDYL-1D-MYO-INOSITOL-34-BISPH]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-177]][c] '''+''' 1 [[Pi]][c]
+
** hnyjhqmusvnwpv-drcjtwaysa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ09331]]
+
** 566.865
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-19202]]
−
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
−
* [[PWY-6368]], 3-phosphoinositide degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6368 PWY-6368]
+
* [[RXN-19200]]
−
** '''6''' reactions found over '''9''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
−
== Reconstruction information  ==
+
{{#set: common-name=diatoxanthin}}
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=hnyjhqmusvnwpv-drcjtwaysa-n}}
−
== External links  ==
+
{{#set: molecular-weight=566.865}}
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=17194 17194]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R07299 R07299]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=phosphatidylinositol-3,4-bisphosphate 4-phosphatase}}
 
−
{{#set: ec-number=ec-3.1.3.66}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-20693

  • common-name:
    • diatoxanthin
  • smiles:
    • cc(=cc=cc=c(c)c=cc=c(c#cc1(=c(c)cc(o)cc(c)(c)1))c)c=cc=c(c)c=cc2(c(c)(c)cc(o)cc(c)=2)
  • inchi-key:
    • hnyjhqmusvnwpv-drcjtwaysa-n
  • molecular-weight:
    • 566.865

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-20693&oldid=138969"