Difference between revisions of "CPD-2181"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7535 == * common-name: ** 9,15,9'-tri-cis-ζ-carotene * smiles: ** cc(=cccc(c)=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(ccc=c(ccc=c(c)c)c)c)...")
(Created page with "Category:metabolite == Metabolite PROTEIN-L-CITRULLINE == * common-name: ** a [protein]-l-citrulline == Reaction(s) known to consume the compound == == Reaction(s) known t...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7535 ==
+
== Metabolite PROTEIN-L-CITRULLINE ==
 
* common-name:
 
* common-name:
** 9,15,9'-tri-cis-ζ-carotene
+
** a [protein]-l-citrulline
* smiles:
 
** cc(=cccc(c)=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(ccc=c(ccc=c(c)c)c)c)c)c)c
 
* inchi-key:
 
** biwlelkafxrpde-lmarsqgmsa-n
 
* molecular-weight:
 
** 540.914
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11354]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11354]]
+
* [[PROTEIN-ARGININE-DEIMINASE-RXN]]
* [[RXN-11355]]
 
* [[RXN-12244]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=9,15,9'-tri-cis-ζ-carotene}}
+
{{#set: common-name=a [protein]-l-citrulline}}
{{#set: inchi-key=inchikey=biwlelkafxrpde-lmarsqgmsa-n}}
 
{{#set: molecular-weight=540.914}}
 

Revision as of 11:15, 15 January 2021

Metabolite PROTEIN-L-CITRULLINE

  • common-name:
    • a [protein]-l-citrulline

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-l-citrulline" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.