Difference between revisions of "CPD-2183"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-67 == * common-name: ** 2-phosphoglycolate * smiles: ** c(op([o-])(=o)[o-])c([o-])=o * inchi-key: ** ascfnmcahfubco-uhfffaoysa-k * mo...") |
(Created page with "Category:metabolite == Metabolite ALLO-THR == * common-name: ** dl-allothreonine == Reaction(s) known to consume the compound == * RXN0-5234 == Reaction(s) known to pr...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ALLO-THR == |
* common-name: | * common-name: | ||
− | ** | + | ** dl-allothreonine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN0-5234]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=dl-allothreonine}} |
− | |||
− |
Revision as of 08:26, 15 March 2021
Contents
Metabolite ALLO-THR
- common-name:
- dl-allothreonine