Difference between revisions of "CPD-2183"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-67 == * common-name: ** 2-phosphoglycolate * smiles: ** c(op([o-])(=o)[o-])c([o-])=o * inchi-key: ** ascfnmcahfubco-uhfffaoysa-k * mo...") |
(Created page with "Category:metabolite == Metabolite CPD-2183 == * common-name: ** 1-oleoyl-2-palmitoyl-phosphatidylglycerol * smiles: ** ccccccccc=ccccccccc(=o)occ(oc(=o)ccccccccccccccc)cop...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-2183 == |
* common-name: | * common-name: | ||
| − | ** 2- | + | ** 1-oleoyl-2-palmitoyl-phosphatidylglycerol |
* smiles: | * smiles: | ||
| − | ** | + | ** ccccccccc=ccccccccc(=o)occ(oc(=o)ccccccccccccccc)cop(=o)([o-])occ(co)o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** gtckewvhtggusn-hgwhepcssa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 748.008 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-1725]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-13313]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=2- | + | {{#set: common-name=1-oleoyl-2-palmitoyl-phosphatidylglycerol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gtckewvhtggusn-hgwhepcssa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=748.008}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-2183
- common-name:
- 1-oleoyl-2-palmitoyl-phosphatidylglycerol
- smiles:
- ccccccccc=ccccccccc(=o)occ(oc(=o)ccccccccccccccc)cop(=o)([o-])occ(co)o
- inchi-key:
- gtckewvhtggusn-hgwhepcssa-m
- molecular-weight:
- 748.008
