Difference between revisions of "CPD-2184"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ01558 == * transcription-direction: ** positive * right-end-position: ** 143774 * left-end-position: ** 125454 * centisome-position: ** 22.803598...")
(Created page with "Category:metabolite == Metabolite CPD-7280 == * common-name: ** (3s,5r,6s)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-β-caroten-12'-al * smiles: ** cc(c=cc=c(c)c=cc12(oc...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ01558 ==
+
== Metabolite CPD-7280 ==
* transcription-direction:
+
* common-name:
** positive
+
** (3s,5r,6s)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-β-caroten-12'-al
* right-end-position:
+
* smiles:
** 143774
+
** cc(c=cc=c(c)c=cc12(oc(cc(o)cc(c)(c)1)2))=cc=cc=c(c)cc=o
* left-end-position:
+
* inchi-key:
** 125454
+
** fyydcjdefsyvoy-wenurhbksa-n
* centisome-position:
+
* molecular-weight:
** 22.803598   
+
** 382.542
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) associated ==
+
* [[RXN-7973-CPD-7424/OXYGEN-MOLECULE//CPD-7279/CPD-7280.44.]]
* [[3.4.19.12-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=(3s,5r,6s)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-β-caroten-12'-al}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=fyydcjdefsyvoy-wenurhbksa-n}}
{{#set: transcription-direction=positive}}
+
{{#set: molecular-weight=382.542}}
{{#set: right-end-position=143774}}
 
{{#set: left-end-position=125454}}
 
{{#set: centisome-position=22.803598    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Revision as of 20:31, 18 December 2020

Metabolite CPD-7280

  • common-name:
    • (3s,5r,6s)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-β-caroten-12'-al
  • smiles:
    • cc(c=cc=c(c)c=cc12(oc(cc(o)cc(c)(c)1)2))=cc=cc=c(c)cc=o
  • inchi-key:
    • fyydcjdefsyvoy-wenurhbksa-n
  • molecular-weight:
    • 382.542

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality