Difference between revisions of "CPD-2184"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDROKAEMPFEROL-CMPD == * common-name: ** (+)-dihydrokaempferol * smiles: ** c1(=c(c=cc(=c1)o)c2(oc3(c(c(c2o)=o)=c(o)c=c(o)c=3))) * inc...") |
(Created page with "Category:metabolite == Metabolite L-Fucopyranoses == * common-name: ** l-fucopyranose == Reaction(s) known to consume the compound == * FUCOKINASE-RXN == Reaction(s) k...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite L-Fucopyranoses == |
* common-name: | * common-name: | ||
− | ** | + | ** l-fucopyranose |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[FUCOKINASE-RXN]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-fucopyranose}} |
− | |||
− |
Revision as of 13:08, 14 January 2021
Contents
Metabolite L-Fucopyranoses
- common-name:
- l-fucopyranose