Difference between revisions of "CPD-2184"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDROKAEMPFEROL-CMPD == * common-name: ** (+)-dihydrokaempferol * smiles: ** c1(=c(c=cc(=c1)o)c2(oc3(c(c(c2o)=o)=c(o)c=c(o)c=3))) * inc...")
(Created page with "Category:metabolite == Metabolite L-Fucopyranoses == * common-name: ** l-fucopyranose == Reaction(s) known to consume the compound == * FUCOKINASE-RXN == Reaction(s) k...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DIHYDROKAEMPFEROL-CMPD ==
+
== Metabolite L-Fucopyranoses ==
 
* common-name:
 
* common-name:
** (+)-dihydrokaempferol
+
** l-fucopyranose
* smiles:
 
** c1(=c(c=cc(=c1)o)c2(oc3(c(c(c2o)=o)=c(o)c=c(o)c=3)))
 
* inchi-key:
 
** padqinqhpqkxnl-lsdhhaiusa-n
 
* molecular-weight:
 
** 288.256
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]]
+
* [[FUCOKINASE-RXN]]
* [[RXN1F-93]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[NARINGENIN-3-DIOXYGENASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(+)-dihydrokaempferol}}
+
{{#set: common-name=l-fucopyranose}}
{{#set: inchi-key=inchikey=padqinqhpqkxnl-lsdhhaiusa-n}}
 
{{#set: molecular-weight=288.256}}
 

Revision as of 13:08, 14 January 2021

Metabolite L-Fucopyranoses

  • common-name:
    • l-fucopyranose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality