Difference between revisions of "CPD-2185"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CIT == * common-name: ** citrate * smiles: ** c(=o)([o-])cc(c(=o)[o-])(o)cc(=o)[o-] * inchi-key: ** krknybchxyngox-uhfffaoysa-k * molecul...") |
(Created page with "Category:metabolite == Metabolite Red-Glutaredoxins == * common-name: ** a reduced glutaredoxin == Reaction(s) known to consume the compound == * RXN-982 == Reaction(s...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Red-Glutaredoxins == |
* common-name: | * common-name: | ||
− | ** | + | ** a reduced glutaredoxin |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-982]] | |
− | |||
− | |||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a reduced glutaredoxin}} |
− | |||
− |
Revision as of 08:24, 15 March 2021
Contents
Metabolite Red-Glutaredoxins
- common-name:
- a reduced glutaredoxin