Difference between revisions of "CPD-2185"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 4-PRENYLPHLORISOBUTYROPHENONE == * common-name: ** 4-prenylphlorisobutyrophenone * smiles: ** cc(=ccc1(=c(c=c(c(=c1o)c(c(c)c)=o)o)[o-]))c...")
(Created page with "Category:metabolite == Metabolite CPD-2185 == * common-name: ** 1-linoleoyl-2-(3e)-hexadecenoyl-phosphatidylglycerol * smiles: ** cccccc=ccc=ccccccccc(=o)occ(oc(=o)cc=cccc...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 4-PRENYLPHLORISOBUTYROPHENONE ==
+
== Metabolite CPD-2185 ==
 
* common-name:
 
* common-name:
** 4-prenylphlorisobutyrophenone
+
** 1-linoleoyl-2-(3e)-hexadecenoyl-phosphatidylglycerol
 
* smiles:
 
* smiles:
** cc(=ccc1(=c(c=c(c(=c1o)c(c(c)c)=o)o)[o-]))c
+
** cccccc=ccc=ccccccccc(=o)occ(oc(=o)cc=ccccccccccccc)cop(=o)([o-])occ(co)o
 
* inchi-key:
 
* inchi-key:
** iobxamcsycvnet-uhfffaoysa-m
+
** qkkvmrcirqqmdu-lugizmlvsa-m
 
* molecular-weight:
 
* molecular-weight:
** 263.313
+
** 743.977
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7813]]
+
* [[RXN-1727]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-8318]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-prenylphlorisobutyrophenone}}
+
{{#set: common-name=1-linoleoyl-2-(3e)-hexadecenoyl-phosphatidylglycerol}}
{{#set: inchi-key=inchikey=iobxamcsycvnet-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=qkkvmrcirqqmdu-lugizmlvsa-m}}
{{#set: molecular-weight=263.313}}
+
{{#set: molecular-weight=743.977}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-2185

  • common-name:
    • 1-linoleoyl-2-(3e)-hexadecenoyl-phosphatidylglycerol
  • smiles:
    • cccccc=ccc=ccccccccc(=o)occ(oc(=o)cc=ccccccccccccc)cop(=o)([o-])occ(co)o
  • inchi-key:
    • qkkvmrcirqqmdu-lugizmlvsa-m
  • molecular-weight:
    • 743.977

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality