Difference between revisions of "CPD-2187"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GAP == * common-name: ** d-glyceraldehyde 3-phosphate * smiles: ** [ch](=o)c(o)cop(=o)([o-])[o-] * inchi-key: ** lxjxrirhzlfyrp-vkhmyheas...") |
(Created page with "Category:metabolite == Metabolite HIS == * common-name: ** l-histidine * smiles: ** c1(nc=nc=1cc(c(=o)[o-])[n+]) * inchi-key: ** hndvdqjcigzpno-yfkpbyrvsa-n * molecular-we...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite HIS == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-histidine |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(nc=nc=1cc(c(=o)[o-])[n+]) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hndvdqjcigzpno-yfkpbyrvsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 155.156 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[HISTIDINE--TRNA-LIGASE-RXN]] |
| − | + | * [[HISTIDINE-AMMONIA-LYASE-RXN]] | |
| − | + | * [[HISTIDINE-DECARBOXYLASE-RXN]] | |
| − | + | * [[biomass_rxn]] | |
| − | |||
| − | |||
| − | |||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[ | ||
| − | |||
| − | * [[ | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[HISTALDEHYD-RXN]] |
| − | * [[ | + | * [[RXN-8001]] |
| − | + | * [[RXN0-6978]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN0- | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-histidine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hndvdqjcigzpno-yfkpbyrvsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=155.156}} |
Revision as of 14:54, 5 January 2021
Contents
Metabolite HIS
- common-name:
- l-histidine
- smiles:
- c1(nc=nc=1cc(c(=o)[o-])[n+])
- inchi-key:
- hndvdqjcigzpno-yfkpbyrvsa-n
- molecular-weight:
- 155.156
