Difference between revisions of "CPD-2187"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite HIS == * common-name: ** l-histidine * smiles: ** c1(nc=nc=1cc(c(=o)[o-])[n+]) * inchi-key: ** hndvdqjcigzpno-yfkpbyrvsa-n * molecular-we...") |
(Created page with "Category:metabolite == Metabolite Protein-tyrosine-phosphates == * common-name: ** a [protein]-l-tyrosine phosphate == Reaction(s) known to consume the compound == * PRO...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Protein-tyrosine-phosphates == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [protein]-l-tyrosine phosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.7.10.1-RXN]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=l- | + | {{#set: common-name=a [protein]-l-tyrosine phosphate}} |
| − | |||
| − | |||
Revision as of 15:25, 5 January 2021
Contents
Metabolite Protein-tyrosine-phosphates
- common-name:
- a [protein]-l-tyrosine phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [protein]-l-tyrosine phosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
