Difference between revisions of "CPD-2190"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14805 RXN-14805] == * direction: ** reversible * common-name: ** trans--2-enoyl-coa hydratase 2...")
(Created page with "Category:metabolite == Metabolite CPD-2190 == * common-name: ** 1-18:3-2-16:3-monogalactosyldiacylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))o...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14805 RXN-14805] ==
+
== Metabolite CPD-2190 ==
* direction:
 
** reversible
 
 
* common-name:
 
* common-name:
** trans--2-enoyl-coa hydratase 2
+
** 1-18:3-2-16:3-monogalactosyldiacylglycerol
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/4.2.1.119 ec-4.2.1.119]
+
** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=ccc=ccc)=o)=o
== Reaction formula ==
+
* inchi-key:
* 1 [[CPD-12777]][c] '''<=>''' 1 [[T2-DECENOYL-COA]][c] '''+''' 1 [[WATER]][c]
+
** zrlaoeyzskxgsl-rzrnqmrlsa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ03584]]
+
** 747.02
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
* Gene: [[SJ04769]]
+
* [[RXN-8301]]
** Category: [[annotation]]
+
* [[RXN-8309]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) of unknown directionality ==
== Pathway(s) ==
+
{{#set: common-name=1-18:3-2-16:3-monogalactosyldiacylglycerol}}
== Reconstruction information  ==
+
{{#set: inchi-key=inchikey=zrlaoeyzskxgsl-rzrnqmrlsa-n}}
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=747.02}}
== External links  ==
 
{{#set: direction=reversible}}
 
{{#set: common-name=trans--2-enoyl-coa hydratase 2}}
 
{{#set: ec-number=ec-4.2.1.119}}
 
{{#set: nb gene associated=2}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-2190

  • common-name:
    • 1-18:3-2-16:3-monogalactosyldiacylglycerol
  • smiles:
    • ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=ccc=ccc)=o)=o
  • inchi-key:
    • zrlaoeyzskxgsl-rzrnqmrlsa-n
  • molecular-weight:
    • 747.02

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality