Difference between revisions of "CPD-2190"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8901 == * common-name: ** a [protein] n6-methyl-l-lysine == Reaction(s) known to consume the compound == * RXN-8661 == Reaction(s...")
(Created page with "Category:metabolite == Metabolite CPD-2190 == * common-name: ** 1-18:3-2-16:3-monogalactosyldiacylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))o...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8901 ==
+
== Metabolite CPD-2190 ==
 
* common-name:
 
* common-name:
** a [protein] n6-methyl-l-lysine
+
** 1-18:3-2-16:3-monogalactosyldiacylglycerol
 +
* smiles:
 +
** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=ccc=ccc)=o)=o
 +
* inchi-key:
 +
** zrlaoeyzskxgsl-rzrnqmrlsa-n
 +
* molecular-weight:
 +
** 747.02
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8661]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8660]]
+
* [[RXN-8301]]
 +
* [[RXN-8309]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [protein] n6-methyl-l-lysine}}
+
{{#set: common-name=1-18:3-2-16:3-monogalactosyldiacylglycerol}}
 +
{{#set: inchi-key=inchikey=zrlaoeyzskxgsl-rzrnqmrlsa-n}}
 +
{{#set: molecular-weight=747.02}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-2190

  • common-name:
    • 1-18:3-2-16:3-monogalactosyldiacylglycerol
  • smiles:
    • ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=ccc=ccc)=o)=o
  • inchi-key:
    • zrlaoeyzskxgsl-rzrnqmrlsa-n
  • molecular-weight:
    • 747.02

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality