Difference between revisions of "CPD-2190"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-Adenosines-37 == * common-name: ** an adenosine37 in trna == Reaction(s) known to consume the compound == * RXN0-6274 == Reactio...") |
(Created page with "Category:metabolite == Metabolite CPD-2190 == * common-name: ** 1-18:3-2-16:3-monogalactosyldiacylglycerol * smiles: ** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))o...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-2190 == |
* common-name: | * common-name: | ||
− | ** | + | ** 1-18:3-2-16:3-monogalactosyldiacylglycerol |
+ | * smiles: | ||
+ | ** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=ccc=ccc)=o)=o | ||
+ | * inchi-key: | ||
+ | ** zrlaoeyzskxgsl-rzrnqmrlsa-n | ||
+ | * molecular-weight: | ||
+ | ** 747.02 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-8301]] | ||
+ | * [[RXN-8309]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=1-18:3-2-16:3-monogalactosyldiacylglycerol}} |
+ | {{#set: inchi-key=inchikey=zrlaoeyzskxgsl-rzrnqmrlsa-n}} | ||
+ | {{#set: molecular-weight=747.02}} |
Revision as of 14:57, 5 January 2021
Contents
Metabolite CPD-2190
- common-name:
- 1-18:3-2-16:3-monogalactosyldiacylglycerol
- smiles:
- ccc=ccc=ccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=ccc=ccc)=o)=o
- inchi-key:
- zrlaoeyzskxgsl-rzrnqmrlsa-n
- molecular-weight:
- 747.02