Difference between revisions of "CPD-22095"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-METHYL-CROTONYL-COA == * common-name: ** 3-methylcrotonyl-coa * smiles: ** cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...")
(Created page with "Category:metabolite == Metabolite 1-3-alpha-D-Glucans == * common-name: ** a 1,3-α-d-glucan == Reaction(s) known to consume the compound == * 3.2.1.84-RXN == Rea...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-METHYL-CROTONYL-COA ==
+
== Metabolite 1-3-alpha-D-Glucans ==
 
* common-name:
 
* common-name:
** 3-methylcrotonyl-coa
+
** a 1,3-α-d-glucan
* smiles:
 
** cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
 
* inchi-key:
 
** bxipalatiynhjn-zmhdxicwsa-j
 
* molecular-weight:
 
** 845.604
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ECH_LPAREN_3hivcoa_RPAREN_]]
+
* [[3.2.1.84-RXN]]
* [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]]
 
* [[RXN-14264]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ECH_LPAREN_3hivcoa_RPAREN_]]
+
* [[3.2.1.84-RXN]]
* [[IVCDH]]
 
* [[RXN-11921]]
 
* [[RXN-14264]]
 
* [[RXN0-2301]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-methylcrotonyl-coa}}
+
{{#set: common-name=a 1,3-α-d-glucan}}
{{#set: inchi-key=inchikey=bxipalatiynhjn-zmhdxicwsa-j}}
 
{{#set: molecular-weight=845.604}}
 

Revision as of 18:55, 14 January 2021

Metabolite 1-3-alpha-D-Glucans

  • common-name:
    • a 1,3-α-d-glucan

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality