Difference between revisions of "CPD-224"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10806 == * common-name: ** 4-hydroxy-2-nonenal * smiles: ** cccccc(o)[ch]=cc=o * inchi-key: ** jvjfiqyahpmbbx-fnorwqnlsa-n * molecula...")
(Created page with "Category:metabolite == Metabolite CPD-11938 == * common-name: ** 1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate * smiles: ** c1(op(=o)([o-])[o-])(c(op(=o)(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-10806 ==
+
== Metabolite CPD-11938 ==
 
* common-name:
 
* common-name:
** 4-hydroxy-2-nonenal
+
** 1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate
 
* smiles:
 
* smiles:
** cccccc(o)[ch]=cc=o
+
** c1(op(=o)([o-])[o-])(c(op(=o)([o-])[o-])c(op([o-])(=o)op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(op([o-])(=o)[o-])([o-])=o)c(op([o-])([o-])=o)1)
 
* inchi-key:
 
* inchi-key:
** jvjfiqyahpmbbx-fnorwqnlsa-n
+
** hhqooerqsfjgep-slwywoedsa-a
 
* molecular-weight:
 
* molecular-weight:
** 156.224
+
** 805.885
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13673]]
+
* [[RXN-10965]]
 +
* [[RXN-10975]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[2.7.4.24-RXN]]
 +
* [[RXN-10965]]
 +
* [[RXN-10974]]
 +
* [[RXN-10975]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-hydroxy-2-nonenal}}
+
{{#set: common-name=1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate}}
{{#set: inchi-key=inchikey=jvjfiqyahpmbbx-fnorwqnlsa-n}}
+
{{#set: inchi-key=inchikey=hhqooerqsfjgep-slwywoedsa-a}}
{{#set: molecular-weight=156.224}}
+
{{#set: molecular-weight=805.885}}

Revision as of 08:27, 15 March 2021

Metabolite CPD-11938

  • common-name:
    • 1d-myo-inositol 1,5-bis(diphosphate) 2,3,4,6-tetrakisphosphate
  • smiles:
    • c1(op(=o)([o-])[o-])(c(op(=o)([o-])[o-])c(op([o-])(=o)op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(op([o-])(=o)[o-])([o-])=o)c(op([o-])([o-])=o)1)
  • inchi-key:
    • hhqooerqsfjgep-slwywoedsa-a
  • molecular-weight:
    • 805.885

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality