Difference between revisions of "CPD-224"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19489 == * common-name: ** 3-isopropyl-8-(methylthio)-2-oxooctanoate * smiles: ** cscccccc(c(=o)c(=o)[o-])c(=o)[o-] * inchi-key: ** y...") |
(Created page with "Category:metabolite == Metabolite CPD-224 == * common-name: ** a dolichyl diphosphate == Reaction(s) known to consume the compound == * DOLICHYLDIPHOSPHATASE-RXN * R...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-224 == |
* common-name: | * common-name: | ||
| − | ** | + | ** a dolichyl diphosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[DOLICHYLDIPHOSPHATASE-RXN]] |
| + | * [[RXN-16761]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[2.4.1.119-RXN]] |
| + | * [[DOLICHYLDIPHOSPHATASE-RXN]] | ||
| + | * [[RXN-16761]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a dolichyl diphosphate}} |
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-224
- common-name:
- a dolichyl diphosphate
