Difference between revisions of "CPD-224"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ14995 == * transcription-direction: ** negative * right-end-position: ** 629687 * left-end-position: ** 607316 * centisome-position: ** 85.75596...")
(Created page with "Category:metabolite == Metabolite CARBOXYMETHYL-HYDROXYPHENYLPROPCOA == * common-name: ** 2-carboxymethyl-3-hydroxyphenylpropanoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ14995 ==
+
== Metabolite CARBOXYMETHYL-HYDROXYPHENYLPROPCOA ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** 2-carboxymethyl-3-hydroxyphenylpropanoyl-coa
−
* right-end-position:
+
* smiles:
−
** 629687
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(c(cc([o-])=o)c(o)c1(=cc=cc=c1))=o)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
−
* left-end-position:
+
* inchi-key:
−
** 607316
+
** dvsqfplmolprdu-acxvelpgsa-i
−
* centisome-position:
+
* molecular-weight:
−
** 85.75596   
+
** 968.692
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-905]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[NADH-DEHYDROG-A-RXN]]
+
* [[RXN-902]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=2-carboxymethyl-3-hydroxyphenylpropanoyl-coa}}
−
* [[NADH-DEHYDROGENASE-QUINONE-RXN]]
+
{{#set: inchi-key=inchikey=dvsqfplmolprdu-acxvelpgsa-i}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=968.692}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[NADH-DEHYDROGENASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN0-5330]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
−
* [[PWY0-1335]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-4302]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-3781]]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY0-1334]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-6692]]
 
−
** '''3''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-5083]]
 
−
** '''5''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-7279]]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY0-1573]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-7269]]
 
−
** '''5''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY0-1568]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY0-1567]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
</div>
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=629687}}
 
−
{{#set: left-end-position=607316}}
 
−
{{#set: centisome-position=85.75596    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=4}}
 
−
{{#set: nb pathway associated=11}}
 

Revision as of 20:33, 18 December 2020

Metabolite CARBOXYMETHYL-HYDROXYPHENYLPROPCOA

  • common-name:
    • 2-carboxymethyl-3-hydroxyphenylpropanoyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(c(cc([o-])=o)c(o)c1(=cc=cc=c1))=o)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • dvsqfplmolprdu-acxvelpgsa-i
  • molecular-weight:
    • 968.692

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-224&oldid=46880"