Difference between revisions of "CPD-224"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CARBOXYMETHYL-HYDROXYPHENYLPROPCOA == * common-name: ** 2-carboxymethyl-3-hydroxyphenylpropanoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)...")
(Created page with "Category:metabolite == Metabolite Sugar-Phosphate == * common-name: ** a sugar phosphate == Reaction(s) known to consume the compound == * SUGAR-PHOSPHATASE-RXN == Rea...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CARBOXYMETHYL-HYDROXYPHENYLPROPCOA ==
+
== Metabolite Sugar-Phosphate ==
 
* common-name:
 
* common-name:
** 2-carboxymethyl-3-hydroxyphenylpropanoyl-coa
+
** a sugar phosphate
* smiles:
 
** cc(c)(c(o)c(=o)nccc(=o)nccsc(c(cc([o-])=o)c(o)c1(=cc=cc=c1))=o)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
* inchi-key:
 
** dvsqfplmolprdu-acxvelpgsa-i
 
* molecular-weight:
 
** 968.692
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-905]]
+
* [[SUGAR-PHOSPHATASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-902]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-carboxymethyl-3-hydroxyphenylpropanoyl-coa}}
+
{{#set: common-name=a sugar phosphate}}
{{#set: inchi-key=inchikey=dvsqfplmolprdu-acxvelpgsa-i}}
 
{{#set: molecular-weight=968.692}}
 

Revision as of 14:56, 5 January 2021

Metabolite Sugar-Phosphate

  • common-name:
    • a sugar phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality