Difference between revisions of "CPD-224"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6741 == * common-name: ** d-myo-inositol (1,2,3,5,6) pentakisphosphate * smiles: ** c1(o)(c(op(=o)([o-])[o-])c(op([o-])(=o)[o-])c(op(...")
(Created page with "Category:metabolite == Metabolite CPD-714 == * common-name: ** cathasterone * smiles: ** cc(c)c(c)cc(o)c(c)[ch]3(cc[ch]4([ch]2(cc(=o)[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34)))) *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-6741 ==
+
== Metabolite CPD-714 ==
 
* common-name:
 
* common-name:
** d-myo-inositol (1,2,3,5,6) pentakisphosphate
+
** cathasterone
 
* smiles:
 
* smiles:
** c1(o)(c(op(=o)([o-])[o-])c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
+
** cc(c)c(c)cc(o)c(c)[ch]3(cc[ch]4([ch]2(cc(=o)[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** ctpqaxvnygzuaj-uotptpdrsa-d
+
** jsvpgvhceqdjcz-vgehdtswsa-n
 
* molecular-weight:
 
* molecular-weight:
** 569.977
+
** 432.685
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7241]]
+
* [[RXN-715]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-myo-inositol (1,2,3,5,6) pentakisphosphate}}
+
{{#set: common-name=cathasterone}}
{{#set: inchi-key=inchikey=ctpqaxvnygzuaj-uotptpdrsa-d}}
+
{{#set: inchi-key=inchikey=jsvpgvhceqdjcz-vgehdtswsa-n}}
{{#set: molecular-weight=569.977}}
+
{{#set: molecular-weight=432.685}}

Revision as of 13:10, 14 January 2021

Metabolite CPD-714

  • common-name:
    • cathasterone
  • smiles:
    • cc(c)c(c)cc(o)c(c)[ch]3(cc[ch]4([ch]2(cc(=o)[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • jsvpgvhceqdjcz-vgehdtswsa-n
  • molecular-weight:
    • 432.685

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality