Difference between revisions of "CPD-22765"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite HEXANOATE == * common-name: ** hexanoate * smiles: ** cccccc([o-])=o * inchi-key: ** fuzzwvxgsfpdmh-uhfffaoysa-m * molecular-weight: ** 1...") |
(Created page with "Category:metabolite == Metabolite CPD-674 == * common-name: ** trans-cinnamate * smiles: ** c(=o)([o-])c=cc1(=cc=cc=c1) * inchi-key: ** wbywaxjhaxsjni-votsokgwsa-m * molec...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-674 == |
* common-name: | * common-name: | ||
| − | ** | + | ** trans-cinnamate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(=o)([o-])c=cc1(=cc=cc=c1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wbywaxjhaxsjni-votsokgwsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 147.153 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-2001]] | ||
| + | * [[TRANS-CINNAMATE-4-MONOOXYGENASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=trans-cinnamate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wbywaxjhaxsjni-votsokgwsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=147.153}} |
Revision as of 08:31, 15 March 2021
Contents
Metabolite CPD-674
- common-name:
- trans-cinnamate
- smiles:
- c(=o)([o-])c=cc1(=cc=cc=c1)
- inchi-key:
- wbywaxjhaxsjni-votsokgwsa-m
- molecular-weight:
- 147.153
