Difference between revisions of "CPD-22766"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ17528 == * transcription-direction: ** negative * right-end-position: ** 15584 * left-end-position: ** 12971 * centisome-position: ** 4.9769974...") |
(Created page with "Category:metabolite == Metabolite CPD-14115 == * common-name: ** (s)-equol * smiles: ** c3(c(c1(cc2(=cc=c(c=c(oc1)2)o)))=cc=c(c=3)o) * inchi-key: ** adfcqwzhkcxpaj-gfccveg...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-14115 == |
| − | * | + | * common-name: |
| − | ** | + | ** (s)-equol |
| − | * | + | * smiles: |
| − | ** | + | ** c3(c(c1(cc2(=cc=c(c=c(oc1)2)o)))=cc=c(c=3)o) |
| − | * | + | * inchi-key: |
| − | ** | + | ** adfcqwzhkcxpaj-gfccvegcsa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 242.274 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-15589]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | * [[RXN- | + | * [[RXN-15589]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=(s)-equol}} | |
| − | + | {{#set: inchi-key=inchikey=adfcqwzhkcxpaj-gfccvegcsa-n}} | |
| − | + | {{#set: molecular-weight=242.274}} | |
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Revision as of 20:34, 18 December 2020
Contents
Metabolite CPD-14115
- common-name:
- (s)-equol
- smiles:
- c3(c(c1(cc2(=cc=c(c=c(oc1)2)o)))=cc=c(c=3)o)
- inchi-key:
- adfcqwzhkcxpaj-gfccvegcsa-n
- molecular-weight:
- 242.274
