Difference between revisions of "CPD-231"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Cyclic-2-3-Ribonucleoside-Monophosphates == * common-name: ** a ribonucleoside 2',3'-cyclic phosphate == Reaction(s) known to consume the...")
(Created page with "Category:metabolite == Metabolite PROPIONYL-COA == * common-name: ** propanoyl-coa * smiles: ** ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Cyclic-2-3-Ribonucleoside-Monophosphates ==
+
== Metabolite PROPIONYL-COA ==
 
* common-name:
 
* common-name:
** a ribonucleoside 2',3'-cyclic phosphate
+
** propanoyl-coa
 +
* smiles:
 +
** ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** qaqrevbbadehpa-iexphmlfsa-j
 +
* molecular-weight:
 +
** 819.566
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.4.37-RXN]]
+
* [[METHYLACETOACETYLCOATHIOL-RXN]]
 +
* [[METHYLMALONYL-COA-DECARBOXYLASE-RXN]]
 +
* [[PPCOAOm]]
 +
* [[PROPIONYL-COA-CARBOXY-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[1.2.1.27-RXN]]
 +
* [[2.3.1.176-RXN]]
 +
* [[ACCAT]]
 +
* [[METHYLACETOACETYLCOATHIOL-RXN]]
 +
* [[METHYLMALONYL-COA-DECARBOXYLASE-RXN]]
 +
* [[PPCOAOm]]
 +
* [[PROPIONYL-COA-CARBOXY-RXN]]
 +
* [[RXN-11213]]
 +
* [[RXN-12561]]
 +
* [[RXN-7790]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a ribonucleoside 2',3'-cyclic phosphate}}
+
{{#set: common-name=propanoyl-coa}}
 +
{{#set: inchi-key=inchikey=qaqrevbbadehpa-iexphmlfsa-j}}
 +
{{#set: molecular-weight=819.566}}

Revision as of 08:28, 15 March 2021

Metabolite PROPIONYL-COA

  • common-name:
    • propanoyl-coa
  • smiles:
    • ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • qaqrevbbadehpa-iexphmlfsa-j
  • molecular-weight:
    • 819.566

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality