Difference between revisions of "CPD-231"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Odd-Straight-Chain-234-Sat-FA == * common-name: ** an odd numbered straight chain 2,3,4-saturated fatty acid == Reaction(s) known to cons...") |
(Created page with "Category:metabolite == Metabolite CPD-7063 == * common-name: ** red chlorophyll catabolite * smiles: ** ccc1(c(c)=c(nc=1c=c4(c(c)=c5(c(=o)[c-](c(oc)=o)c(c2(c(ccc(=o)[o-])c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-7063 == |
* common-name: | * common-name: | ||
| − | ** | + | ** red chlorophyll catabolite |
| + | * smiles: | ||
| + | ** ccc1(c(c)=c(nc=1c=c4(c(c)=c5(c(=o)[c-](c(oc)=o)c(c2(c(ccc(=o)[o-])c(c)c(n=2)=cc3(c(c)=c(c=c)c(=o)n3)))=c(n4)5)))c=o) | ||
| + | * inchi-key: | ||
| + | ** gvtpycxgtfqzdt-yssugppcsa-m | ||
| + | * molecular-weight: | ||
| + | ** 624.692 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-7741]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-7740]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=red chlorophyll catabolite}} |
| + | {{#set: inchi-key=inchikey=gvtpycxgtfqzdt-yssugppcsa-m}} | ||
| + | {{#set: molecular-weight=624.692}} | ||
Revision as of 13:10, 14 January 2021
Contents
Metabolite CPD-7063
- common-name:
- red chlorophyll catabolite
- smiles:
- ccc1(c(c)=c(nc=1c=c4(c(c)=c5(c(=o)[c-](c(oc)=o)c(c2(c(ccc(=o)[o-])c(c)c(n=2)=cc3(c(c)=c(c=c)c(=o)n3)))=c(n4)5)))c=o)
- inchi-key:
- gvtpycxgtfqzdt-yssugppcsa-m
- molecular-weight:
- 624.692
