Difference between revisions of "CPD-237"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10267 == * common-name: ** decanoyl-coa * smiles: ** cccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-]...") |
(Created page with "Category:metabolite == Metabolite CPD-237 == * common-name: ** (indol-3-yl)acetamide * smiles: ** c(n)(=o)cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** zoambxdogprzlp-uhfffaoysa-...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-237 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (indol-3-yl)acetamide |
* smiles: | * smiles: | ||
| − | ** | + | ** c(n)(=o)cc1(=cnc2(c=cc=cc1=2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zoambxdogprzlp-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 174.202 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXNN-404]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[TRYPTOPHAN-2-MONOOXYGENASE-RXN]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(indol-3-yl)acetamide}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zoambxdogprzlp-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=174.202}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-237
- common-name:
- (indol-3-yl)acetamide
- smiles:
- c(n)(=o)cc1(=cnc2(c=cc=cc1=2))
- inchi-key:
- zoambxdogprzlp-uhfffaoysa-n
- molecular-weight:
- 174.202
