Difference between revisions of "CPD-237"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ14459 == * transcription-direction: ** negative * right-end-position: ** 127756 * left-end-position: ** 115738 * centisome-position: ** 36.763462...") |
(Created page with "Category:metabolite == Metabolite CPD-237 == * common-name: ** (indol-3-yl)acetamide * smiles: ** c(n)(=o)cc1(=cnc2(c=cc=cc1=2)) * inchi-key: ** zoambxdogprzlp-uhfffaoysa-...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-237 == |
| − | * | + | * common-name: |
| − | ** | + | ** (indol-3-yl)acetamide |
| − | * | + | * smiles: |
| − | ** | + | ** c(n)(=o)cc1(=cnc2(c=cc=cc1=2)) |
| − | * | + | * inchi-key: |
| − | ** | + | ** zoambxdogprzlp-uhfffaoysa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 174.202 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXNN-404]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[TRYPTOPHAN-2-MONOOXYGENASE-RXN]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=(indol-3-yl)acetamide}} | |
| − | + | {{#set: inchi-key=inchikey=zoambxdogprzlp-uhfffaoysa-n}} | |
| − | + | {{#set: molecular-weight=174.202}} | |
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-237
- common-name:
- (indol-3-yl)acetamide
- smiles:
- c(n)(=o)cc1(=cnc2(c=cc=cc1=2))
- inchi-key:
- zoambxdogprzlp-uhfffaoysa-n
- molecular-weight:
- 174.202
