Difference between revisions of "CPD-24184"

Revision as of 11:14, 15 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-9446 ==
+== Metabolite GLUTATHIONE ==
 * common-name:
-** 1,5-anhydro-d-mannitol
+** glutathione
 * smiles:
-** c(o)c1(occ(o)c(o)c(o)1)
+** c(s)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
 * inchi-key:
-** mpcajmnynogxpb-kvtdhhqdsa-n
+** rwsxrvcmgqzwbv-wdskdsinsa-m
 * molecular-weight:
-** 164.158
+** 306.313
 == Reaction(s) known to consume the compound ==
-* [[RXN-13064]]
+* [[1.11.1.12-RXN]]
+* [[1.8.4.9-RXN]]
+* [[1.8.5.1-RXN]]
+* [[2.3.2.15-RXN]]
+* [[GLUTATHIONE-PEROXIDASE-RXN]]
+* [[GLYOXI-RXN]]
+* [[GSHTRAN-RXN]]
+* [[GST-RXN]]
+* [[GTHP]]
+* [[LEUKOTRIENE-C4-SYNTHASE-RXN]]
+* [[RXN-12618]]
+* [[RXN-13673]]
+* [[RXN-15680]]
+* [[RXN-18092]]
+* [[RXN-6601]]
+* [[RXN-9157]]
 == Reaction(s) known to produce the compound ==
+* [[GDR]]
+* [[GDR_LPAREN_nadp_RPAREN_]]
+* [[GDR_LPAREN_nadp_RPAREN_h]]
+* [[GDR_LPAREN_nadp_RPAREN_m]]
+* [[GDRh]]
+* [[GDRm]]
+* [[GLUTATHIONE-REDUCT-NADPH-RXN]]
+* [[GLUTATHIONE-SYN-RXN]]
+* [[GLYOXI-RXN]]
+* [[GLYOXII-RXN]]
+* [[GST-RXN]]
+* [[RXN-13161]]
+* [[RXN-7919]]
+* [[S-FORMYLGLUTATHIONE-HYDROLASE-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=1,5-anhydro-d-mannitol}}
+{{#set: common-name=glutathione}}
-{{#set: inchi-key=inchikey=mpcajmnynogxpb-kvtdhhqdsa-n}}
+{{#set: inchi-key=inchikey=rwsxrvcmgqzwbv-wdskdsinsa-m}}
-{{#set: molecular-weight=164.158}}
+{{#set: molecular-weight=306.313}}